C18H27BO5 — CID 151600251
3-[2-ethoxy-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenoxy]propanoic acid (PubChem CID 151600251) has the molecular formula C18H27BO5 and a molecular weight of 334.22 g/mol. Its IUPAC name is 3-[2-ethoxy-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenoxy]propanoic acid.
| Compound Name | 3-[2-ethoxy-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 151600251 |
| Molecular Formula | C18H27BO5 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-[2-ethoxy-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenoxy]propanoic acid |
| SMILES | CCOc1cc(B2CC(C)(C)C(C)(C)O2)ccc1OCCC(=O)O |
| InChI | InChI=1S/C18H27BO5/c1-6-22-15-11-13(7-8-14(15)23-10-9-16(20)21)19-12-17(2,3)18(4,5)24-19/h7-8,11H,6,9-10,12H2,1-5H3,(H,20,21) |
| InChIKey | QKIMFTKXCSKYIY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|