C24H27BrF2N6O2Si — CID 151603950
N-[3-bromo-2-[2-(difluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 151603950) has the molecular formula C24H27BrF2N6O2Si and a molecular weight of 577.51 g/mol. Its IUPAC name is N-[3-bromo-2-[2-(difluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[3-bromo-2-[2-(difluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 151603950 |
| Molecular Formula | C24H27BrF2N6O2Si |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | N-[3-bromo-2-[2-(difluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1ncnc1C(=O)Nc1cc2c(cn1)c(Br)c(-c1ccccc1C(F)F)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H27BrF2N6O2Si/c1-32-23(29-13-30-32)24(34)31-19-11-18-17(12-28-19)20(25)21(15-7-5-6-8-16(15)22(26)27)33(18)14-35-9-10-36(2,3)4/h5-8,11-13,22H,9-10,14H2,1-4H3,(H,28,31,34) |
| InChIKey | QLBOEZHIRVYICV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|