About 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol
2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol (PubChem CID 15160990) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol |
| PubChem CID | 15160990 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol |
| SMILES | CC1(C)c2cc(O)ccc2OC1CO |
| InChI | InChI=1S/C11H14O3/c1-11(2)8-5-7(13)3-4-9(8)14-10(11)6-12/h3-5,10,12-13H,6H2,1-2H3 |
| InChIKey | ALRYLTIRVVMKOP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol?
The IUPAC name of 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol (CID 15160990) is 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol.
What is the SMILES notation for 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol?
The canonical SMILES for 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol is CC1(C)c2cc(O)ccc2OC1CO.
What is the InChIKey of 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol?
The InChIKey is ALRYLTIRVVMKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-11(2)8-5-7(13)3-4-9(8)14-10(11)6-12/h3-5,10,12-13H,6H2,1-2H3.
What are the key properties of 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol?
2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol has a molecular weight of 194.23 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3,3-dimethyl-2H-1-benzofuran-5-ol is sourced from PubChem (CID 15160990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).