About [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone
[3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone (PubChem CID 151609910) has the molecular formula C24H22N6O
and a molecular weight of 410.48 g/mol. Its IUPAC name is [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone.
Molecular Properties
| Compound Name | [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone |
| PubChem CID | 151609910 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cccc(-c2ccc3ncnc(Nc4ccccc4)c3n2)c1)N1CCNCC1 |
| InChI | InChI=1S/C24H22N6O/c31-24(30-13-11-25-12-14-30)18-6-4-5-17(15-18)20-9-10-21-22(29-20)23(27-16-26-21)28-19-7-2-1-3-8-19/h1-10,15-16,25H,11-14H2,(H,26,27,28) |
| InChIKey | QMGSUOKNDYZFEM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone?
The IUPAC name of [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone (CID 151609910) is [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone.
What is the SMILES notation for [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone?
The canonical SMILES for [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone is O=C(c1cccc(-c2ccc3ncnc(Nc4ccccc4)c3n2)c1)N1CCNCC1.
What is the InChIKey of [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone?
The InChIKey is QMGSUOKNDYZFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N6O/c31-24(30-13-11-25-12-14-30)18-6-4-5-17(15-18)20-9-10-21-22(29-20)23(27-16-26-21)28-19-7-2-1-3-8-19/h1-10,15-16,25H,11-14H2,(H,26,27,28).
What are the key properties of [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone?
[3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone has a molecular weight of 410.48 g/mol, XLogP of 3.48, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-anilinopyrido[3,2-d]pyrimidin-6-yl)phenyl]-piperazin-1-ylmethanone is sourced from PubChem (CID 151609910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).