About azepine-2,4-diimine
azepine-2,4-diimine (PubChem CID 151609983) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is azepine-2,4-diimine.
Molecular Properties
| Compound Name | azepine-2,4-diimine |
| PubChem CID | 151609983 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | azepine-2,4-diimine |
| SMILES | [H]/N=C1\C=CC=N/C(=N\[H])C1 |
| InChI | InChI=1S/C6H7N3/c7-5-2-1-3-9-6(8)4-5/h1-3,7-8H,4H2/b7-5+,8-6- |
| InChIKey | QMHCNKPBFMEOSD-YMBWGVAGSA-N |
| XLogP | 1.01 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze azepine-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepine-2,4-diimine?
The IUPAC name of azepine-2,4-diimine (CID 151609983) is azepine-2,4-diimine.
What is the SMILES notation for azepine-2,4-diimine?
The canonical SMILES for azepine-2,4-diimine is [H]/N=C1\C=CC=N/C(=N\[H])C1.
What is the InChIKey of azepine-2,4-diimine?
The InChIKey is QMHCNKPBFMEOSD-YMBWGVAGSA-N. The full InChI is InChI=1S/C6H7N3/c7-5-2-1-3-9-6(8)4-5/h1-3,7-8H,4H2/b7-5+,8-6-.
What are the key properties of azepine-2,4-diimine?
azepine-2,4-diimine has a molecular weight of 121.14 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepine-2,4-diimine is sourced from PubChem (CID 151609983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).