C17H24BClN2O3 — CID 151612682
1-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]-2-methylpropan-2-ol (PubChem CID 151612682) has the molecular formula C17H24BClN2O3 and a molecular weight of 350.66 g/mol. Its IUPAC name is 1-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 151612682 |
| Molecular Formula | C17H24BClN2O3 |
| Molecular Weight | 350.66 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)Cn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C17H24BClN2O3/c1-15(2,22)10-21-9-11-13(20-21)8-7-12(14(11)19)18-23-16(3,4)17(5,6)24-18/h7-9,22H,10H2,1-6H3 |
| InChIKey | QMVNPPUOKMDAJI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|