C28H35F4N3O2Si — CID 151614521
N-[(4-cyclohexylphenyl)methyl]-2,2,2-trifluoro-N-[5-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]acetamide (PubChem CID 151614521) has the molecular formula C28H35F4N3O2Si and a molecular weight of 549.69 g/mol. Its IUPAC name is N-[(4-cyclohexylphenyl)methyl]-2,2,2-trifluoro-N-[5-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]acetamide.
| Compound Name | N-[(4-cyclohexylphenyl)methyl]-2,2,2-trifluoro-N-[5-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]acetamide |
|---|---|
| PubChem CID | 151614521 |
| Molecular Formula | C28H35F4N3O2Si |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | N-[(4-cyclohexylphenyl)methyl]-2,2,2-trifluoro-N-[5-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]acetamide |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc(F)c(N(Cc3ccc(C4CCCCC4)cc3)C(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C28H35F4N3O2Si/c1-38(2,3)14-13-37-19-35-25-16-26(24(29)15-23(25)17-33-35)34(27(36)28(30,31)32)18-20-9-11-22(12-10-20)21-7-5-4-6-8-21/h9-12,15-17,21H,4-8,13-14,18-19H2,1-3H3 |
| InChIKey | QNFACERLPNPTDP-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|