C20H24F3N3O3 — CID 151616686
N-[(1R,2S)-1-[4-[6-(2-aminooxybutan-2-yl)-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-difluoroacetamide (PubChem CID 151616686) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-[(1R,2S)-1-[4-[6-(2-aminooxybutan-2-yl)-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-difluoroacetamide.
| Compound Name | N-[(1R,2S)-1-[4-[6-(2-aminooxybutan-2-yl)-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 151616686 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-[(1R,2S)-1-[4-[6-(2-aminooxybutan-2-yl)-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-difluoroacetamide |
| SMILES | CCC(C)(ON)c1ccc(-c2ccc([C@@H](O)[C@@H](CF)NC(=O)C(F)F)cc2)cn1 |
| InChI | InChI=1S/C20H24F3N3O3/c1-3-20(2,29-24)16-9-8-14(11-25-16)12-4-6-13(7-5-12)17(27)15(10-21)26-19(28)18(22)23/h4-9,11,15,17-18,27H,3,10,24H2,1-2H3,(H,26,28)/t15-,17-,20?/m1/s1 |
| InChIKey | QNQVAEOLHMZZOA-LSOHHRALSA-N |
| XLogP | 3.02 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|