N-decylsulfamoyl fluoride

C10H22FNO2S — CID 151617025

IUPACN-decylsulfamoyl fluoride
SMILESCCCCCCCCCCNS(=O)(=O)F
InChIInChI=1S/C10H22FNO2S/c1-2-3-4-5-6-7-8-9-10-12-15(11,13)14/h12H,2-10H2,1H3
InChIKeyQNSMISQFERZBGQ-UHFFFAOYSA-N
MW239.36 g/mol
LogP2.93
Rot. Bonds10

About N-decylsulfamoyl fluoride

N-decylsulfamoyl fluoride (PubChem CID 151617025) has the molecular formula C10H22FNO2S and a molecular weight of 239.36 g/mol. Its IUPAC name is N-decylsulfamoyl fluoride.

Molecular Properties

Compound NameN-decylsulfamoyl fluoride
PubChem CID151617025
Molecular FormulaC10H22FNO2S
Molecular Weight239.36 g/mol
Exact Mass239.14
IUPAC NameN-decylsulfamoyl fluoride
SMILESCCCCCCCCCCNS(=O)(=O)F
InChIInChI=1S/C10H22FNO2S/c1-2-3-4-5-6-7-8-9-10-12-15(11,13)14/h12H,2-10H2,1H3
InChIKeyQNSMISQFERZBGQ-UHFFFAOYSA-N
XLogP2.93
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.36
LogP ≤ 52.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze N-decylsulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-decylsulfamoyl fluoride?
The IUPAC name of N-decylsulfamoyl fluoride (CID 151617025) is N-decylsulfamoyl fluoride.
What is the SMILES notation for N-decylsulfamoyl fluoride?
The canonical SMILES for N-decylsulfamoyl fluoride is CCCCCCCCCCNS(=O)(=O)F.
What is the InChIKey of N-decylsulfamoyl fluoride?
The InChIKey is QNSMISQFERZBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22FNO2S/c1-2-3-4-5-6-7-8-9-10-12-15(11,13)14/h12H,2-10H2,1H3.
What are the key properties of N-decylsulfamoyl fluoride?
N-decylsulfamoyl fluoride has a molecular weight of 239.36 g/mol, XLogP of 2.93, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-decylsulfamoyl fluoride is sourced from PubChem (CID 151617025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).