C10H11F13OSi — CID 151619344
(2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)silane (PubChem CID 151619344) has the molecular formula C10H11F13OSi and a molecular weight of 422.26 g/mol. Its IUPAC name is (2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)silane.
| Compound Name | (2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)silane |
|---|---|
| PubChem CID | 151619344 |
| Molecular Formula | C10H11F13OSi |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | (2-ethyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)silane |
| SMILES | CCC(CO[SiH3])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F13OSi/c1-2-4(3-24-25)5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h4H,2-3H2,1,25H3 |
| InChIKey | QOECEHPKRFWPIQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|