About methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate
methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate (PubChem CID 15161940) has the molecular formula C19H19NO2S2
and a molecular weight of 357.50 g/mol. Its IUPAC name is methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate |
| PubChem CID | 15161940 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate |
| SMILES | CNC1=C(C(=O)OC)SC(c2ccccc2)(c2ccccc2)SC1 |
| InChI | InChI=1S/C19H19NO2S2/c1-20-16-13-23-19(14-9-5-3-6-10-14,15-11-7-4-8-12-15)24-17(16)18(21)22-2/h3-12,20H,13H2,1-2H3 |
| InChIKey | WUJITHYLOUDZIM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate?
The IUPAC name of methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate (CID 15161940) is methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate.
What is the SMILES notation for methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate?
The canonical SMILES for methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate is CNC1=C(C(=O)OC)SC(c2ccccc2)(c2ccccc2)SC1.
What is the InChIKey of methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate?
The InChIKey is WUJITHYLOUDZIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2S2/c1-20-16-13-23-19(14-9-5-3-6-10-14,15-11-7-4-8-12-15)24-17(16)18(21)22-2/h3-12,20H,13H2,1-2H3.
What are the key properties of methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate?
methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate has a molecular weight of 357.50 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(methylamino)-2,2-diphenyl-4H-1,3-dithiine-6-carboxylate is sourced from PubChem (CID 15161940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).