C22H19NO8 — CID 15162104
tetramethyl 13-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10-hexaene-9,10,11,12-tetracarboxylate (PubChem CID 15162104) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is tetramethyl 13-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10-hexaene-9,10,11,12-tetracarboxylate.
| Compound Name | tetramethyl 13-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10-hexaene-9,10,11,12-tetracarboxylate |
|---|---|
| PubChem CID | 15162104 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | tetramethyl 13-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10-hexaene-9,10,11,12-tetracarboxylate |
| SMILES | COC(=O)C1=C2C=Cc3cccc4c3N2C(C(=O)OC)(C4)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C22H19NO8/c1-28-18(24)14-13-9-8-11-6-5-7-12-10-22(21(27)31-4,23(13)17(11)12)16(20(26)30-3)15(14)19(25)29-2/h5-9H,10H2,1-4H3 |
| InChIKey | NJGPUCDLLVWJSX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|