C27H37NO3 — CID 151625140
[(6aR,10aR)-9-cyano-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate (PubChem CID 151625140) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is [(6aR,10aR)-9-cyano-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate.
| Compound Name | [(6aR,10aR)-9-cyano-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate |
|---|---|
| PubChem CID | 151625140 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | [(6aR,10aR)-9-cyano-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(C)=O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C#N)C[C@@H]21 |
| InChI | InChI=1S/C27H37NO3/c1-7-8-9-10-13-26(3,4)20-15-23(30-18(2)29)25-21-14-19(17-28)11-12-22(21)27(5,6)31-24(25)16-20/h11,15-16,21-22H,7-10,12-14H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | QPIHNGDXAOPEEI-FGZHOGPDSA-N |
| XLogP | 6.97 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|