About (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane
(6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane (PubChem CID 15162520) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane.
Molecular Properties
| Compound Name | (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane |
| PubChem CID | 15162520 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane |
| SMILES | C=C1CCO[C@@]2(CCCCO2)C1 |
| InChI | InChI=1S/C10H16O2/c1-9-4-7-12-10(8-9)5-2-3-6-11-10/h1-8H2/t10-/m0/s1 |
| InChIKey | GCSOFARIYYVEPM-JTQLQIEISA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane?
The IUPAC name of (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane (CID 15162520) is (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane.
What is the SMILES notation for (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane?
The canonical SMILES for (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane is C=C1CCO[C@@]2(CCCCO2)C1.
What is the InChIKey of (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane?
The InChIKey is GCSOFARIYYVEPM-JTQLQIEISA-N. The full InChI is InChI=1S/C10H16O2/c1-9-4-7-12-10(8-9)5-2-3-6-11-10/h1-8H2/t10-/m0/s1.
What are the key properties of (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane?
(6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane has a molecular weight of 168.24 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-4-methylidene-1,7-dioxaspiro[5.5]undecane is sourced from PubChem (CID 15162520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).