About 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine
3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine (PubChem CID 15162607) has the molecular formula C10H10F3N3O
and a molecular weight of 245.20 g/mol. Its IUPAC name is 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine |
| PubChem CID | 15162607 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine |
| SMILES | C#CCCCCOc1ncc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C10H10F3N3O/c1-2-3-4-5-6-17-9-14-7-8(15-16-9)10(11,12)13/h1,7H,3-6H2 |
| InChIKey | NXIJNOJRCIEYGY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine?
The IUPAC name of 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine (CID 15162607) is 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine.
What is the SMILES notation for 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine?
The canonical SMILES for 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine is C#CCCCCOc1ncc(C(F)(F)F)nn1.
What is the InChIKey of 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine?
The InChIKey is NXIJNOJRCIEYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3O/c1-2-3-4-5-6-17-9-14-7-8(15-16-9)10(11,12)13/h1,7H,3-6H2.
What are the key properties of 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine?
3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine has a molecular weight of 245.20 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hex-5-ynoxy-6-(trifluoromethyl)-1,2,4-triazine is sourced from PubChem (CID 15162607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).