About 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine
6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine (PubChem CID 15162614) has the molecular formula C9H8F3NS
and a molecular weight of 219.23 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine |
| PubChem CID | 15162614 |
| Molecular Formula | C9H8F3NS |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine |
| SMILES | FC(F)(F)c1cnc2c(c1)CCCS2 |
| InChI | InChI=1S/C9H8F3NS/c10-9(11,12)7-4-6-2-1-3-14-8(6)13-5-7/h4-5H,1-3H2 |
| InChIKey | ZCMPJZUYQPYWBH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine?
The IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine (CID 15162614) is 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine.
What is the SMILES notation for 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine?
The canonical SMILES for 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine is FC(F)(F)c1cnc2c(c1)CCCS2.
What is the InChIKey of 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine?
The InChIKey is ZCMPJZUYQPYWBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NS/c10-9(11,12)7-4-6-2-1-3-14-8(6)13-5-7/h4-5H,1-3H2.
What are the key properties of 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine?
6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine has a molecular weight of 219.23 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-3,4-dihydro-2H-thiopyrano[2,3-b]pyridine is sourced from PubChem (CID 15162614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).