C11H12O3 — CID 15162625
3,7,7-trimethyl-7aH-1-benzofuran-2,4-dione (PubChem CID 15162625) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3,7,7-trimethyl-7aH-1-benzofuran-2,4-dione.
| Compound Name | 3,7,7-trimethyl-7aH-1-benzofuran-2,4-dione |
|---|---|
| PubChem CID | 15162625 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3,7,7-trimethyl-7aH-1-benzofuran-2,4-dione |
| SMILES | CC1=C2C(=O)C=CC(C)(C)C2OC1=O |
| InChI | InChI=1S/C11H12O3/c1-6-8-7(12)4-5-11(2,3)9(8)14-10(6)13/h4-5,9H,1-3H3 |
| InChIKey | QWYFYUKUYUUFDC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |