C14H30N2O4 — CID 151627200
1,1,1-trimethoxydecan-2-ylurea (PubChem CID 151627200) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 1,1,1-trimethoxydecan-2-ylurea.
| Compound Name | 1,1,1-trimethoxydecan-2-ylurea |
|---|---|
| PubChem CID | 151627200 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1,1,1-trimethoxydecan-2-ylurea |
| SMILES | CCCCCCCCC(NC(N)=O)C(OC)(OC)OC |
| InChI | InChI=1S/C14H30N2O4/c1-5-6-7-8-9-10-11-12(16-13(15)17)14(18-2,19-3)20-4/h12H,5-11H2,1-4H3,(H3,15,16,17) |
| InChIKey | QPTFPAVUAGPMDC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|