C28H32N4O6 — CID 15162831
3-morpholin-4-yl-N-[6-(3-morpholin-4-ylpropanoylamino)-9,10-dioxoanthracen-2-yl]propanamide (PubChem CID 15162831) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[6-(3-morpholin-4-ylpropanoylamino)-9,10-dioxoanthracen-2-yl]propanamide.
| Compound Name | 3-morpholin-4-yl-N-[6-(3-morpholin-4-ylpropanoylamino)-9,10-dioxoanthracen-2-yl]propanamide |
|---|---|
| PubChem CID | 15162831 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 3-morpholin-4-yl-N-[6-(3-morpholin-4-ylpropanoylamino)-9,10-dioxoanthracen-2-yl]propanamide |
| SMILES | O=C(CCN1CCOCC1)Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)CCN3CCOCC3)cc1C2=O |
| InChI | InChI=1S/C28H32N4O6/c33-25(5-7-31-9-13-37-14-10-31)29-19-1-3-21-23(17-19)28(36)22-4-2-20(18-24(22)27(21)35)30-26(34)6-8-32-11-15-38-16-12-32/h1-4,17-18H,5-16H2,(H,29,33)(H,30,34) |
| InChIKey | MNNVTJGXKLOOHK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|