C24H30F3N3O4SSi — CID 151628875
trimethyl-[2-[[10-(4-methylphenyl)sulfonyl-13-(trifluoromethyl)-14-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-4-yl]methoxy]ethyl]silane (PubChem CID 151628875) has the molecular formula C24H30F3N3O4SSi and a molecular weight of 541.67 g/mol. Its IUPAC name is trimethyl-[2-[[10-(4-methylphenyl)sulfonyl-13-(trifluoromethyl)-14-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-4-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[10-(4-methylphenyl)sulfonyl-13-(trifluoromethyl)-14-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-4-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 151628875 |
| Molecular Formula | C24H30F3N3O4SSi |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | trimethyl-[2-[[10-(4-methylphenyl)sulfonyl-13-(trifluoromethyl)-14-oxa-2,4,10-triazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-4-yl]methoxy]ethyl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(F)(F)F)Oc3nc4c(ccn4COCC[Si](C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C24H30F3N3O4SSi/c1-17-5-7-19(8-6-17)35(31,32)30-12-10-21(24(25,26)27)34-23-20(30)15-18-9-11-29(22(18)28-23)16-33-13-14-36(2,3)4/h5-9,11,15,21H,10,12-14,16H2,1-4H3 |
| InChIKey | QQBVOUGNVLROJS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|