C10H13NO3 — CID 15162894
(1R,2R)-2-amino-1,2,3,4-tetrahydronaphthalene-1,6,7-triol (PubChem CID 15162894) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (1R,2R)-2-amino-1,2,3,4-tetrahydronaphthalene-1,6,7-triol.
| Compound Name | (1R,2R)-2-amino-1,2,3,4-tetrahydronaphthalene-1,6,7-triol |
|---|---|
| PubChem CID | 15162894 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (1R,2R)-2-amino-1,2,3,4-tetrahydronaphthalene-1,6,7-triol |
| SMILES | N[C@@H]1CCc2cc(O)c(O)cc2[C@H]1O |
| InChI | InChI=1S/C10H13NO3/c11-7-2-1-5-3-8(12)9(13)4-6(5)10(7)14/h3-4,7,10,12-14H,1-2,11H2/t7-,10-/m1/s1 |
| InChIKey | DTKDYAXITHKMGK-GMSGAONNSA-N |
| XLogP | 0.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|