C31H40O5 — CID 151632085
4-[3-[4-(2-cyclohexylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid (PubChem CID 151632085) has the molecular formula C31H40O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is 4-[3-[4-(2-cyclohexylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid.
| Compound Name | 4-[3-[4-(2-cyclohexylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 151632085 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 4-[3-[4-(2-cyclohexylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethyl-3-propan-2-yloxybenzoic acid |
| SMILES | Cc1cc(C(=O)C=Cc2cc(C)c(C(=O)O)c(C)c2OC(C)C)cc(C)c1OCCC1CCCCC1 |
| InChI | InChI=1S/C31H40O5/c1-19(2)36-30-23(6)28(31(33)34)20(3)16-25(30)12-13-27(32)26-17-21(4)29(22(5)18-26)35-15-14-24-10-8-7-9-11-24/h12-13,16-19,24H,7-11,14-15H2,1-6H3,(H,33,34) |
| InChIKey | QQSQIVQDGQYDOE-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|