C11H11F3N2O2 — CID 151632198
1-(6-amino-7-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (PubChem CID 151632198) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 1-(6-amino-7-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(6-amino-7-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 151632198 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(6-amino-7-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| SMILES | Nc1cc2c(cc1O)CN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)10(18)16-2-1-6-3-8(15)9(17)4-7(6)5-16/h3-4,17H,1-2,5,15H2 |
| InChIKey | QQTGBIOSDCHHHI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|