C8H14N2 — CID 151632523
1-ethyl-2,6-dimethyl-2H-pyrimidine (PubChem CID 151632523) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-ethyl-2,6-dimethyl-2H-pyrimidine.
| Compound Name | 1-ethyl-2,6-dimethyl-2H-pyrimidine |
|---|---|
| PubChem CID | 151632523 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-ethyl-2,6-dimethyl-2H-pyrimidine |
| SMILES | CCN1C(C)=CC=NC1C |
| InChI | InChI=1S/C8H14N2/c1-4-10-7(2)5-6-9-8(10)3/h5-6,8H,4H2,1-3H3 |
| InChIKey | QQUUQZYYFAILRK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |