About 2-(chloromethyl)-4,5-dimethoxypyridine
2-(chloromethyl)-4,5-dimethoxypyridine (PubChem CID 15163464) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is 2-(chloromethyl)-4,5-dimethoxypyridine.
Molecular Properties
| Compound Name | 2-(chloromethyl)-4,5-dimethoxypyridine |
| PubChem CID | 15163464 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(chloromethyl)-4,5-dimethoxypyridine |
| SMILES | COc1cnc(CCl)cc1OC |
| InChI | InChI=1S/C8H10ClNO2/c1-11-7-3-6(4-9)10-5-8(7)12-2/h3,5H,4H2,1-2H3 |
| InChIKey | QBSKSROSQDNTHL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-4,5-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-4,5-dimethoxypyridine?
The IUPAC name of 2-(chloromethyl)-4,5-dimethoxypyridine (CID 15163464) is 2-(chloromethyl)-4,5-dimethoxypyridine.
What is the SMILES notation for 2-(chloromethyl)-4,5-dimethoxypyridine?
The canonical SMILES for 2-(chloromethyl)-4,5-dimethoxypyridine is COc1cnc(CCl)cc1OC.
What is the InChIKey of 2-(chloromethyl)-4,5-dimethoxypyridine?
The InChIKey is QBSKSROSQDNTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO2/c1-11-7-3-6(4-9)10-5-8(7)12-2/h3,5H,4H2,1-2H3.
What are the key properties of 2-(chloromethyl)-4,5-dimethoxypyridine?
2-(chloromethyl)-4,5-dimethoxypyridine has a molecular weight of 187.63 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-4,5-dimethoxypyridine is sourced from PubChem (CID 15163464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).