C17H15F4N3O4S — CID 15163495
2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole (PubChem CID 15163495) has the molecular formula C17H15F4N3O4S and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole.
| Compound Name | 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 15163495 |
| Molecular Formula | C17H15F4N3O4S |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
| SMILES | COc1ccnc(CS(=O)c2nc3ccc(OC(F)(F)C(F)F)cc3[nH]2)c1OC |
| InChI | InChI=1S/C17H15F4N3O4S/c1-26-13-5-6-22-12(14(13)27-2)8-29(25)16-23-10-4-3-9(7-11(10)24-16)28-17(20,21)15(18)19/h3-7,15H,8H2,1-2H3,(H,23,24) |
| InChIKey | AKVTWJCUGUZDRQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|