C18H17F4N3O4S — CID 15163497
2-[(4,5-dimethoxy-3-methyl-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole (PubChem CID 15163497) has the molecular formula C18H17F4N3O4S and a molecular weight of 447.41 g/mol. Its IUPAC name is 2-[(4,5-dimethoxy-3-methyl-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole.
| Compound Name | 2-[(4,5-dimethoxy-3-methyl-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 15163497 |
| Molecular Formula | C18H17F4N3O4S |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-[(4,5-dimethoxy-3-methyl-2-pyridinyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
| SMILES | COc1cnc(CS(=O)c2nc3ccc(OC(F)(F)C(F)F)cc3[nH]2)c(C)c1OC |
| InChI | InChI=1S/C18H17F4N3O4S/c1-9-13(23-7-14(27-2)15(9)28-3)8-30(26)17-24-11-5-4-10(6-12(11)25-17)29-18(21,22)16(19)20/h4-7,16H,8H2,1-3H3,(H,24,25) |
| InChIKey | XARXMWDEYLBKMF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|