About 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one
6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one (PubChem CID 15163670) has the molecular formula C10H6BrNO4
and a molecular weight of 284.07 g/mol. Its IUPAC name is 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one.
Molecular Properties
| Compound Name | 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one |
| PubChem CID | 15163670 |
| Molecular Formula | C10H6BrNO4 |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one |
| SMILES | O=c1oc(CBr)nc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C10H6BrNO4/c11-3-9-12-6-2-8-7(14-4-15-8)1-5(6)10(13)16-9/h1-2H,3-4H2 |
| InChIKey | RWZFUOABCBXLPD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one?
The IUPAC name of 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one (CID 15163670) is 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one.
What is the SMILES notation for 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one?
The canonical SMILES for 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one is O=c1oc(CBr)nc2cc3c(cc12)OCO3.
What is the InChIKey of 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one?
The InChIKey is RWZFUOABCBXLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrNO4/c11-3-9-12-6-2-8-7(14-4-15-8)1-5(6)10(13)16-9/h1-2H,3-4H2.
What are the key properties of 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one?
6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one has a molecular weight of 284.07 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)-[1,3]dioxolo[4,5-g][3,1]benzoxazin-8-one is sourced from PubChem (CID 15163670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).