C20H29NO2 — CID 151639091
2-methylpentan-3-yl 7,8,9,9a,10,10a-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate (PubChem CID 151639091) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-methylpentan-3-yl 7,8,9,9a,10,10a-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate.
| Compound Name | 2-methylpentan-3-yl 7,8,9,9a,10,10a-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 151639091 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-methylpentan-3-yl 7,8,9,9a,10,10a-hexahydro-2H-cyclopenta[h][1]benzazepine-1-carboxylate |
| SMILES | CCC(OC(=O)N1CC=CC=C2C=C3CCCC3CC21)C(C)C |
| InChI | InChI=1S/C20H29NO2/c1-4-19(14(2)3)23-20(22)21-11-6-5-8-17-12-15-9-7-10-16(15)13-18(17)21/h5-6,8,12,14,16,18-19H,4,7,9-11,13H2,1-3H3 |
| InChIKey | QSDJXAQLNZTEKZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |