C12H10F7N5 — CID 15164318
N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-(2H-tetrazol-5-ylmethyl)aniline (PubChem CID 15164318) has the molecular formula C12H10F7N5 and a molecular weight of 357.23 g/mol. Its IUPAC name is N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-(2H-tetrazol-5-ylmethyl)aniline.
| Compound Name | N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-(2H-tetrazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 15164318 |
| Molecular Formula | C12H10F7N5 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-(2H-tetrazol-5-ylmethyl)aniline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CNc1ccc(Cc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C12H10F7N5/c13-10(14,11(15,16)12(17,18)19)6-20-8-3-1-7(2-4-8)5-9-21-23-24-22-9/h1-4,20H,5-6H2,(H,21,22,23,24) |
| InChIKey | FYVOPWHEFZFBLS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|