C16H10F15N5 — CID 15164319
N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-4-(2H-tetrazol-5-ylmethyl)aniline (PubChem CID 15164319) has the molecular formula C16H10F15N5 and a molecular weight of 557.26 g/mol. Its IUPAC name is N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-4-(2H-tetrazol-5-ylmethyl)aniline.
| Compound Name | N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-4-(2H-tetrazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 15164319 |
| Molecular Formula | C16H10F15N5 |
| Molecular Weight | 557.26 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-4-(2H-tetrazol-5-ylmethyl)aniline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CNc1ccc(Cc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C16H10F15N5/c17-10(18,6-32-8-3-1-7(2-4-8)5-9-33-35-36-34-9)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h1-4,32H,5-6H2,(H,33,34,35,36) |
| InChIKey | QRKIZZRPTVWFRB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|