C19H16F15NO — CID 15164350
N-benzyl-N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide (PubChem CID 15164350) has the molecular formula C19H16F15NO and a molecular weight of 559.31 g/mol. Its IUPAC name is N-benzyl-N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide.
| Compound Name | N-benzyl-N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
|---|---|
| PubChem CID | 15164350 |
| Molecular Formula | C19H16F15NO |
| Molecular Weight | 559.31 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | N-benzyl-N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H16F15NO/c1-2-3-9-35(10-11-7-5-4-6-8-11)12(36)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)34/h4-8H,2-3,9-10H2,1H3 |
| InChIKey | WIHJPZKIDYRHRU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.31 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|