C13H10F15NO — CID 15164363
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-piperidin-1-yloctan-1-one (PubChem CID 15164363) has the molecular formula C13H10F15NO and a molecular weight of 481.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-piperidin-1-yloctan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-piperidin-1-yloctan-1-one |
|---|---|
| PubChem CID | 15164363 |
| Molecular Formula | C13H10F15NO |
| Molecular Weight | 481.20 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-piperidin-1-yloctan-1-one |
| SMILES | O=C(N1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F15NO/c14-7(15,6(30)29-4-2-1-3-5-29)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h1-5H2 |
| InChIKey | SMQVMVNUQHKMQS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.20 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|