About (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate
(6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate (PubChem CID 151644316) has the molecular formula C13H14O3S
and a molecular weight of 250.32 g/mol. Its IUPAC name is (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate |
| PubChem CID | 151644316 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate |
| SMILES | CC(=O)OCc1csc2c(C)c(O)cc(C)c12 |
| InChI | InChI=1S/C13H14O3S/c1-7-4-11(15)8(2)13-12(7)10(6-17-13)5-16-9(3)14/h4,6,15H,5H2,1-3H3 |
| InChIKey | QTEMNFGZJAFTOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate?
The IUPAC name of (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate (CID 151644316) is (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate.
What is the SMILES notation for (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate?
The canonical SMILES for (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate is CC(=O)OCc1csc2c(C)c(O)cc(C)c12.
What is the InChIKey of (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate?
The InChIKey is QTEMNFGZJAFTOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3S/c1-7-4-11(15)8(2)13-12(7)10(6-17-13)5-16-9(3)14/h4,6,15H,5H2,1-3H3.
What are the key properties of (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate?
(6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate has a molecular weight of 250.32 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-hydroxy-4,7-dimethyl-1-benzothiophen-3-yl)methyl acetate is sourced from PubChem (CID 151644316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).