C18H17FN2O5 — CID 151646408
[7-[[[(2S)-1-amino-1-oxopropan-2-yl]amino]methyl]-1,3-benzodioxol-4-yl] 3-fluorobenzoate (PubChem CID 151646408) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is [7-[[[(2S)-1-amino-1-oxopropan-2-yl]amino]methyl]-1,3-benzodioxol-4-yl] 3-fluorobenzoate.
| Compound Name | [7-[[[(2S)-1-amino-1-oxopropan-2-yl]amino]methyl]-1,3-benzodioxol-4-yl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 151646408 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [7-[[[(2S)-1-amino-1-oxopropan-2-yl]amino]methyl]-1,3-benzodioxol-4-yl] 3-fluorobenzoate |
| SMILES | C[C@H](NCc1ccc(OC(=O)c2cccc(F)c2)c2c1OCO2)C(N)=O |
| InChI | InChI=1S/C18H17FN2O5/c1-10(17(20)22)21-8-12-5-6-14(16-15(12)24-9-25-16)26-18(23)11-3-2-4-13(19)7-11/h2-7,10,21H,8-9H2,1H3,(H2,20,22)/t10-/m0/s1 |
| InChIKey | QTPKSJBPTZTGGY-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|