C30H58F2O2Si2 — CID 151650976
tert-butyl-[(E,3S,5S)-1-[2-[tert-butyl(dimethyl)silyl]oxy-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]-5-methylnon-1-en-3-yl]oxy-dimethylsilane (PubChem CID 151650976) has the molecular formula C30H58F2O2Si2 and a molecular weight of 544.96 g/mol. Its IUPAC name is tert-butyl-[(E,3S,5S)-1-[2-[tert-butyl(dimethyl)silyl]oxy-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]-5-methylnon-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S,5S)-1-[2-[tert-butyl(dimethyl)silyl]oxy-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]-5-methylnon-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 151650976 |
| Molecular Formula | C30H58F2O2Si2 |
| Molecular Weight | 544.96 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | tert-butyl-[(E,3S,5S)-1-[2-[tert-butyl(dimethyl)silyl]oxy-6,6-difluoro-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]-5-methylnon-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/C1C(O[Si](C)(C)C(C)(C)C)CC2CCC(F)(F)C21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58F2O2Si2/c1-13-14-15-22(2)20-24(33-35(9,10)28(3,4)5)16-17-25-26(34-36(11,12)29(6,7)8)21-23-18-19-30(31,32)27(23)25/h16-17,22-27H,13-15,18-21H2,1-12H3/b17-16+/t22-,23?,24+,25?,26?,27?/m0/s1 |
| InChIKey | QUMUELZGBOFFMQ-ZTKUDADJSA-N |
| XLogP | 10.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.96 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|