About [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate
[3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate (PubChem CID 15165156) has the molecular formula C5H9N3O12
and a molecular weight of 303.14 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate.
Molecular Properties
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate |
| PubChem CID | 15165156 |
| Molecular Formula | C5H9N3O12 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate |
| SMILES | O=[N+]([O-])OC(O[N+](=O)[O-])(O[N+](=O)[O-])C(CO)(CO)CO |
| InChI | InChI=1S/C5H9N3O12/c9-1-4(2-10,3-11)5(18-6(12)13,19-7(14)15)20-8(16)17/h9-11H,1-3H2 |
| InChIKey | FHIRLPOUDZACRQ-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 217.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate?
The IUPAC name of [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate (CID 15165156) is [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate.
What is the SMILES notation for [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate?
The canonical SMILES for [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate is O=[N+]([O-])OC(O[N+](=O)[O-])(O[N+](=O)[O-])C(CO)(CO)CO.
What is the InChIKey of [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate?
The InChIKey is FHIRLPOUDZACRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O12/c9-1-4(2-10,3-11)5(18-6(12)13,19-7(14)15)20-8(16)17/h9-11H,1-3H2.
What are the key properties of [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate?
[3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate has a molecular weight of 303.14 g/mol, XLogP of -2.77, 10 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-2,2-bis(hydroxymethyl)-1,1-dinitrooxypropyl] nitrate is sourced from PubChem (CID 15165156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).