C34H36N2O4S2 — CID 15165551
N-(4-butoxyphenyl)-2-[[2-[(4-butoxyphenyl)carbamoyl]phenyl]disulfanyl]benzamide (PubChem CID 15165551) has the molecular formula C34H36N2O4S2 and a molecular weight of 600.81 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-[[2-[(4-butoxyphenyl)carbamoyl]phenyl]disulfanyl]benzamide.
| Compound Name | N-(4-butoxyphenyl)-2-[[2-[(4-butoxyphenyl)carbamoyl]phenyl]disulfanyl]benzamide |
|---|---|
| PubChem CID | 15165551 |
| Molecular Formula | C34H36N2O4S2 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | N-(4-butoxyphenyl)-2-[[2-[(4-butoxyphenyl)carbamoyl]phenyl]disulfanyl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)c2ccccc2SSc2ccccc2C(=O)Nc2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C34H36N2O4S2/c1-3-5-23-39-27-19-15-25(16-20-27)35-33(37)29-11-7-9-13-31(29)41-42-32-14-10-8-12-30(32)34(38)36-26-17-21-28(22-18-26)40-24-6-4-2/h7-22H,3-6,23-24H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | UCQTYXWEPMMQAX-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|