C27H39BN2O2 — CID 151656721
1-[4-(2-methylbutyl)phenyl]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (PubChem CID 151656721) has the molecular formula C27H39BN2O2 and a molecular weight of 434.43 g/mol. Its IUPAC name is 1-[4-(2-methylbutyl)phenyl]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine.
| Compound Name | 1-[4-(2-methylbutyl)phenyl]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 151656721 |
| Molecular Formula | C27H39BN2O2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 1-[4-(2-methylbutyl)phenyl]-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| SMILES | CCC(C)Cc1ccc(N2CCN(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H39BN2O2/c1-7-21(2)20-22-8-12-24(13-9-22)29-16-18-30(19-17-29)25-14-10-23(11-15-25)28-31-26(3,4)27(5,6)32-28/h8-15,21H,7,16-20H2,1-6H3 |
| InChIKey | QVQPYZNSTGGGSB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|