About 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one
1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one (PubChem CID 15165871) has the molecular formula C8H12ClN2OS+
and a molecular weight of 219.72 g/mol. Its IUPAC name is 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one.
Molecular Properties
| Compound Name | 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one |
| PubChem CID | 15165871 |
| Molecular Formula | C8H12ClN2OS+ |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one |
| SMILES | Cn1cc[n+](C)c1SCC(=O)CCl |
| InChI | InChI=1S/C8H12ClN2OS/c1-10-3-4-11(2)8(10)13-6-7(12)5-9/h3-4H,5-6H2,1-2H3/q+1 |
| InChIKey | OVFWSEDQPAYGOK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one?
The IUPAC name of 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one (CID 15165871) is 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one.
What is the SMILES notation for 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one?
The canonical SMILES for 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one is Cn1cc[n+](C)c1SCC(=O)CCl.
What is the InChIKey of 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one?
The InChIKey is OVFWSEDQPAYGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN2OS/c1-10-3-4-11(2)8(10)13-6-7(12)5-9/h3-4H,5-6H2,1-2H3/q+1.
What are the key properties of 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one?
1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one has a molecular weight of 219.72 g/mol, XLogP of 0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one is sourced from PubChem (CID 15165871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).