About 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride
1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride (PubChem CID 15165872) has the molecular formula C13H16ClN3O2S2
and a molecular weight of 345.88 g/mol. Its IUPAC name is 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride.
Molecular Properties
| Compound Name | 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride |
| PubChem CID | 15165872 |
| Molecular Formula | C13H16ClN3O2S2 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride |
| SMILES | Cn1cc[n+](C)c1SCC(=O)CSc1cccc[n+]1[O-].[Cl-] |
| InChI | InChI=1S/C13H16N3O2S2.ClH/c1-14-7-8-15(2)13(14)20-10-11(17)9-19-12-5-3-4-6-16(12)18;/h3-8H,9-10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WIQQDTVPVPRLQM-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride?
The IUPAC name of 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride (CID 15165872) is 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride.
What is the SMILES notation for 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride?
The canonical SMILES for 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride is Cn1cc[n+](C)c1SCC(=O)CSc1cccc[n+]1[O-].[Cl-].
What is the InChIKey of 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride?
The InChIKey is WIQQDTVPVPRLQM-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H16N3O2S2.ClH/c1-14-7-8-15(2)13(14)20-10-11(17)9-19-12-5-3-4-6-16(12)18;/h3-8H,9-10H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride?
1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride has a molecular weight of 345.88 g/mol, XLogP of -2.06, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethylimidazol-1-ium-2-yl)sulfanyl-3-(1-oxidopyridin-1-ium-2-yl)sulfanylpropan-2-one chloride is sourced from PubChem (CID 15165872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).