About 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one
3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one (PubChem CID 151659680) has the molecular formula C15H24O2
and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one.
Molecular Properties
| Compound Name | 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one |
| PubChem CID | 151659680 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one |
| SMILES | CCCCC(CC)CC(=O)C1(OC)C=CC=C1 |
| InChI | InChI=1S/C15H24O2/c1-4-6-9-13(5-2)12-14(16)15(17-3)10-7-8-11-15/h7-8,10-11,13H,4-6,9,12H2,1-3H3 |
| InChIKey | QWGQONRVKLJCNL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one?
The IUPAC name of 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one (CID 151659680) is 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one.
What is the SMILES notation for 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one?
The canonical SMILES for 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one is CCCCC(CC)CC(=O)C1(OC)C=CC=C1.
What is the InChIKey of 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one?
The InChIKey is QWGQONRVKLJCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-4-6-9-13(5-2)12-14(16)15(17-3)10-7-8-11-15/h7-8,10-11,13H,4-6,9,12H2,1-3H3.
What are the key properties of 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one?
3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one has a molecular weight of 236.36 g/mol, XLogP of 3.67, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-(1-methoxycyclopenta-2,4-dien-1-yl)heptan-1-one is sourced from PubChem (CID 151659680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).