About 1-methylpyrazole-3,4-diamine
1-methylpyrazole-3,4-diamine (PubChem CID 15166013) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is 1-methylpyrazole-3,4-diamine.
Molecular Properties
| Compound Name | 1-methylpyrazole-3,4-diamine |
| PubChem CID | 15166013 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | 1-methylpyrazole-3,4-diamine |
| SMILES | Cn1cc(N)c(N)n1 |
| InChI | InChI=1S/C4H8N4/c1-8-2-3(5)4(6)7-8/h2H,5H2,1H3,(H2,6,7) |
| InChIKey | LOQVLQHJQFWANA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpyrazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazole-3,4-diamine?
The IUPAC name of 1-methylpyrazole-3,4-diamine (CID 15166013) is 1-methylpyrazole-3,4-diamine.
What is the SMILES notation for 1-methylpyrazole-3,4-diamine?
The canonical SMILES for 1-methylpyrazole-3,4-diamine is Cn1cc(N)c(N)n1.
What is the InChIKey of 1-methylpyrazole-3,4-diamine?
The InChIKey is LOQVLQHJQFWANA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c1-8-2-3(5)4(6)7-8/h2H,5H2,1H3,(H2,6,7).
What are the key properties of 1-methylpyrazole-3,4-diamine?
1-methylpyrazole-3,4-diamine has a molecular weight of 112.14 g/mol, XLogP of -0.42, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazole-3,4-diamine is sourced from PubChem (CID 15166013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).