C22H20F4N4O2S2 — CID 151660570
6-(3-cyano-1-cyclobutyl-5-fluoro-6-sulfanylindol-2-yl)-N-[(2S)-1,1,1-trifluorobutan-2-yl]pyridine-3-sulfonamide (PubChem CID 151660570) has the molecular formula C22H20F4N4O2S2 and a molecular weight of 512.55 g/mol. Its IUPAC name is 6-(3-cyano-1-cyclobutyl-5-fluoro-6-sulfanylindol-2-yl)-N-[(2S)-1,1,1-trifluorobutan-2-yl]pyridine-3-sulfonamide.
| Compound Name | 6-(3-cyano-1-cyclobutyl-5-fluoro-6-sulfanylindol-2-yl)-N-[(2S)-1,1,1-trifluorobutan-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 151660570 |
| Molecular Formula | C22H20F4N4O2S2 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 6-(3-cyano-1-cyclobutyl-5-fluoro-6-sulfanylindol-2-yl)-N-[(2S)-1,1,1-trifluorobutan-2-yl]pyridine-3-sulfonamide |
| SMILES | CC[C@H](NS(=O)(=O)c1ccc(-c2c(C#N)c3cc(F)c(S)cc3n2C2CCC2)nc1)C(F)(F)F |
| InChI | InChI=1S/C22H20F4N4O2S2/c1-2-20(22(24,25)26)29-34(31,32)13-6-7-17(28-11-13)21-15(10-27)14-8-16(23)19(33)9-18(14)30(21)12-4-3-5-12/h6-9,11-12,20,29,33H,2-5H2,1H3/t20-/m0/s1 |
| InChIKey | QWLCUQCOQODGQM-FQEVSTJZSA-N |
| XLogP | 5.35 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|