About 3,5-diisocyanatobenzene-1,2-dithiol
3,5-diisocyanatobenzene-1,2-dithiol (PubChem CID 151663331) has the molecular formula C8H4N2O2S2
and a molecular weight of 224.27 g/mol. Its IUPAC name is 3,5-diisocyanatobenzene-1,2-dithiol.
Molecular Properties
| Compound Name | 3,5-diisocyanatobenzene-1,2-dithiol |
| PubChem CID | 151663331 |
| Molecular Formula | C8H4N2O2S2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | 3,5-diisocyanatobenzene-1,2-dithiol |
| SMILES | O=C=Nc1cc(S)c(S)c(N=C=O)c1 |
| InChI | InChI=1S/C8H4N2O2S2/c11-3-9-5-1-6(10-4-12)8(14)7(13)2-5/h1-2,13-14H |
| InChIKey | QWZQIDWCMPPPBY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diisocyanatobenzene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diisocyanatobenzene-1,2-dithiol?
The IUPAC name of 3,5-diisocyanatobenzene-1,2-dithiol (CID 151663331) is 3,5-diisocyanatobenzene-1,2-dithiol.
What is the SMILES notation for 3,5-diisocyanatobenzene-1,2-dithiol?
The canonical SMILES for 3,5-diisocyanatobenzene-1,2-dithiol is O=C=Nc1cc(S)c(S)c(N=C=O)c1.
What is the InChIKey of 3,5-diisocyanatobenzene-1,2-dithiol?
The InChIKey is QWZQIDWCMPPPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2S2/c11-3-9-5-1-6(10-4-12)8(14)7(13)2-5/h1-2,13-14H.
What are the key properties of 3,5-diisocyanatobenzene-1,2-dithiol?
3,5-diisocyanatobenzene-1,2-dithiol has a molecular weight of 224.27 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diisocyanatobenzene-1,2-dithiol is sourced from PubChem (CID 151663331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).