C16H19N3O2 — CID 151665969
3-cyclobutyl-6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-1H-pyrimidine-2,4-dione (PubChem CID 151665969) has the molecular formula C16H19N3O2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-cyclobutyl-6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-cyclobutyl-6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 151665969 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-cyclobutyl-6-[[(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)ethyl]amino]-1H-pyrimidine-2,4-dione |
| SMILES | [2H]c1c([2H])c([2H])c([C@H](C)Nc2cc(=O)n(C3CCC3)c(=O)[nH]2)c([2H])c1[2H] |
| InChI | InChI=1S/C16H19N3O2/c1-11(12-6-3-2-4-7-12)17-14-10-15(20)19(16(21)18-14)13-8-5-9-13/h2-4,6-7,10-11,13,17H,5,8-9H2,1H3,(H,18,21)/t11-/m0/s1/i2D,3D,4D,6D,7D |
| InChIKey | QXNMPBBSISVXGG-CJFAVPRESA-N |
| XLogP | 2.43 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |