C26H29ClFNO4 — CID 151667198
N-[(3-chloro-2-fluorophenyl)methyl]-4-hydroxy-8-(2-methylpropyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 151667198) has the molecular formula C26H29ClFNO4 and a molecular weight of 473.97 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-4-hydroxy-8-(2-methylpropyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-4-hydroxy-8-(2-methylpropyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 151667198 |
| Molecular Formula | C26H29ClFNO4 |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-4-hydroxy-8-(2-methylpropyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | CC(C)CC1CCCC2C(=O)C3=C(C=C(C(=O)NCc4cccc(Cl)c4F)C(=O)C3O)CC12 |
| InChI | InChI=1S/C26H29ClFNO4/c1-13(2)9-14-5-3-7-17-18(14)10-16-11-19(24(31)25(32)21(16)23(17)30)26(33)29-12-15-6-4-8-20(27)22(15)28/h4,6,8,11,13-14,17-18,25,32H,3,5,7,9-10,12H2,1-2H3,(H,29,33) |
| InChIKey | QXTYXPPSGLGVAV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|