C24H31F3N4O3 — CID 151667322
methyl 4-[1-[3-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydroimidazo[4,5-h][3]benzazepin-2-yl]piperidin-4-yl]butanoate (PubChem CID 151667322) has the molecular formula C24H31F3N4O3 and a molecular weight of 480.53 g/mol. Its IUPAC name is methyl 4-[1-[3-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydroimidazo[4,5-h][3]benzazepin-2-yl]piperidin-4-yl]butanoate.
| Compound Name | methyl 4-[1-[3-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydroimidazo[4,5-h][3]benzazepin-2-yl]piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 151667322 |
| Molecular Formula | C24H31F3N4O3 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | methyl 4-[1-[3-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydroimidazo[4,5-h][3]benzazepin-2-yl]piperidin-4-yl]butanoate |
| SMILES | COC(=O)CCCC1CCN(c2nc3cc4c(cc3n2C)CCN(C(=O)C(F)(F)F)CC4)CC1 |
| InChI | InChI=1S/C24H31F3N4O3/c1-29-20-15-18-9-13-30(22(33)24(25,26)27)12-8-17(18)14-19(20)28-23(29)31-10-6-16(7-11-31)4-3-5-21(32)34-2/h14-16H,3-13H2,1-2H3 |
| InChIKey | QXUOPNNQLVIELP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |