C10H12N2 — CID 15166842
2-(1,2,3,6-tetrahydropyridin-4-yl)pyridine (PubChem CID 15166842) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(1,2,3,6-tetrahydropyridin-4-yl)pyridine.
| Compound Name | 2-(1,2,3,6-tetrahydropyridin-4-yl)pyridine |
|---|---|
| PubChem CID | 15166842 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-(1,2,3,6-tetrahydropyridin-4-yl)pyridine |
| SMILES | C1=C(c2ccccn2)CCNC1 |
| InChI | InChI=1S/C10H12N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h1-4,6,11H,5,7-8H2 |
| InChIKey | IVRPDZRVHKIBBG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |