About bicyclo[2.2.1]hept-5-ene-2,2-dithiol
bicyclo[2.2.1]hept-5-ene-2,2-dithiol (PubChem CID 151668461) has the molecular formula C7H10S2
and a molecular weight of 158.29 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2,2-dithiol.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-5-ene-2,2-dithiol |
| PubChem CID | 151668461 |
| Molecular Formula | C7H10S2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2,2-dithiol |
| SMILES | SC1(S)CC2C=CC1C2 |
| InChI | InChI=1S/C7H10S2/c8-7(9)4-5-1-2-6(7)3-5/h1-2,5-6,8-9H,3-4H2 |
| InChIKey | QYAIACPFMPOWCX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-5-ene-2,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-5-ene-2,2-dithiol?
The IUPAC name of bicyclo[2.2.1]hept-5-ene-2,2-dithiol (CID 151668461) is bicyclo[2.2.1]hept-5-ene-2,2-dithiol.
What is the SMILES notation for bicyclo[2.2.1]hept-5-ene-2,2-dithiol?
The canonical SMILES for bicyclo[2.2.1]hept-5-ene-2,2-dithiol is SC1(S)CC2C=CC1C2.
What is the InChIKey of bicyclo[2.2.1]hept-5-ene-2,2-dithiol?
The InChIKey is QYAIACPFMPOWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10S2/c8-7(9)4-5-1-2-6(7)3-5/h1-2,5-6,8-9H,3-4H2.
What are the key properties of bicyclo[2.2.1]hept-5-ene-2,2-dithiol?
bicyclo[2.2.1]hept-5-ene-2,2-dithiol has a molecular weight of 158.29 g/mol, XLogP of 2.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-5-ene-2,2-dithiol is sourced from PubChem (CID 151668461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).